About ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine
ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine (PubChem CID 171654346) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine |
| PubChem CID | 171654346 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine |
| SMILES | CC.Cc1ccc2c(n1)OCO2 |
| InChI | InChI=1S/C7H7NO2.C2H6/c1-5-2-3-6-7(8-5)10-4-9-6;1-2/h2-3H,4H2,1H3;1-2H3 |
| InChIKey | XDVJWMONZUKZEL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine?
The IUPAC name of ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine (CID 171654346) is ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine.
What is the SMILES notation for ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine?
The canonical SMILES for ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine is CC.Cc1ccc2c(n1)OCO2.
What is the InChIKey of ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine?
The InChIKey is XDVJWMONZUKZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H6/c1-5-2-3-6-7(8-5)10-4-9-6;1-2/h2-3H,4H2,1H3;1-2H3.
What are the key properties of ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine?
ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine has a molecular weight of 167.21 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-[1,3]dioxolo[4,5-b]pyridine is sourced from PubChem (CID 171654346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).