About 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile
6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile (PubChem CID 170324009) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile.
Analyze 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile?
The IUPAC name of 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile (CID 170324009) is 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile is Cc1cc2c(nc1C#N)OCO2.
What is the InChIKey of 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile?
The InChIKey is DERGOSIULBSBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c1-5-2-7-8(12-4-11-7)10-6(5)3-9/h2H,4H2,1H3.
What are the key properties of 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile?
6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile has a molecular weight of 162.15 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1,3]dioxolo[4,5-b]pyridine-5-carbonitrile is sourced from PubChem (CID 170324009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).