C16H21ClO3 — CID 105112683
2-(3-chlorophenoxy)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol (PubChem CID 105112683) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol.
| Compound Name | 2-(3-chlorophenoxy)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol |
|---|---|
| PubChem CID | 105112683 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-(5-oxaspiro[3.5]nonan-8-yl)ethanol |
| SMILES | OC(COc1cccc(Cl)c1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H21ClO3/c17-13-3-1-4-14(9-13)19-11-15(18)12-5-8-20-16(10-12)6-2-7-16/h1,3-4,9,12,15,18H,2,5-8,10-11H2 |
| InChIKey | MTIWMXKFXMWNFF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |