2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid

C9H12O3 — CID 10511300

IUPAC2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid
SMILESCC1=C(CC(=O)O)C(=O)CC1C
InChIInChI=1S/C9H12O3/c1-5-3-8(10)7(6(5)2)4-9(11)12/h5H,3-4H2,1-2H3,(H,11,12)
InChIKeyCYGLJJWXHPTZLI-UHFFFAOYSA-N
MW168.19 g/mol
LogP1.39
Rot. Bonds2

About 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid

2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid (PubChem CID 10511300) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid.

Molecular Properties

Compound Name2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid
PubChem CID10511300
Molecular FormulaC9H12O3
Molecular Weight168.19 g/mol
Exact Mass168.08
IUPAC Name2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid
SMILESCC1=C(CC(=O)O)C(=O)CC1C
InChIInChI=1S/C9H12O3/c1-5-3-8(10)7(6(5)2)4-9(11)12/h5H,3-4H2,1-2H3,(H,11,12)
InChIKeyCYGLJJWXHPTZLI-UHFFFAOYSA-N
XLogP1.39
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.19
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid?
The IUPAC name of 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid (CID 10511300) is 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid.
What is the SMILES notation for 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid?
The canonical SMILES for 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid is CC1=C(CC(=O)O)C(=O)CC1C.
What is the InChIKey of 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid?
The InChIKey is CYGLJJWXHPTZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-5-3-8(10)7(6(5)2)4-9(11)12/h5H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid?
2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid has a molecular weight of 168.19 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid is sourced from PubChem (CID 10511300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).