C9H12O3 — CID 10511300
2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid (PubChem CID 10511300) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid.
| Compound Name | 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid |
|---|---|
| PubChem CID | 10511300 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(2,3-dimethyl-5-oxocyclopenten-1-yl)acetic acid |
| SMILES | CC1=C(CC(=O)O)C(=O)CC1C |
| InChI | InChI=1S/C9H12O3/c1-5-3-8(10)7(6(5)2)4-9(11)12/h5H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | CYGLJJWXHPTZLI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |