C14H22N2O3S — CID 105116403
2,6-dioxaspiro[4.5]decan-9-yl-(4-propylthiadiazol-5-yl)methanol (PubChem CID 105116403) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl-(4-propylthiadiazol-5-yl)methanol.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl-(4-propylthiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105116403 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl-(4-propylthiadiazol-5-yl)methanol |
| SMILES | CCCc1nnsc1C(O)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C14H22N2O3S/c1-2-3-11-13(20-16-15-11)12(17)10-4-6-19-14(8-10)5-7-18-9-14/h10,12,17H,2-9H2,1H3 |
| InChIKey | SYPKHYXHKPYNML-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |