C15H19ClO4S — CID 105117657
2-(3-chlorophenoxy)-1-(3-methylsulfonylcyclohexyl)ethanone (PubChem CID 105117657) has the molecular formula C15H19ClO4S and a molecular weight of 330.83 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-(3-methylsulfonylcyclohexyl)ethanone.
| Compound Name | 2-(3-chlorophenoxy)-1-(3-methylsulfonylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 105117657 |
| Molecular Formula | C15H19ClO4S |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-(3-methylsulfonylcyclohexyl)ethanone |
| SMILES | CS(=O)(=O)C1CCCC(C(=O)COc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H19ClO4S/c1-21(18,19)14-7-2-4-11(8-14)15(17)10-20-13-6-3-5-12(16)9-13/h3,5-6,9,11,14H,2,4,7-8,10H2,1H3 |
| InChIKey | MCGMMVWRKQOQTN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |