C10H13F3N2O — CID 105120629
5,5,5-trifluoro-1-(5-methylpyrazin-2-yl)pentan-1-ol (PubChem CID 105120629) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(5-methylpyrazin-2-yl)pentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-(5-methylpyrazin-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 105120629 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 5,5,5-trifluoro-1-(5-methylpyrazin-2-yl)pentan-1-ol |
| SMILES | Cc1cnc(C(O)CCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H13F3N2O/c1-7-5-15-8(6-14-7)9(16)3-2-4-10(11,12)13/h5-6,9,16H,2-4H2,1H3 |
| InChIKey | KVULJCHERKYUQF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |