C16H13N3O — CID 105121617
(3,6-dimethylpyridazin-4-yl)-quinolin-6-ylmethanone (PubChem CID 105121617) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is (3,6-dimethylpyridazin-4-yl)-quinolin-6-ylmethanone.
| Compound Name | (3,6-dimethylpyridazin-4-yl)-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 105121617 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (3,6-dimethylpyridazin-4-yl)-quinolin-6-ylmethanone |
| SMILES | Cc1cc(C(=O)c2ccc3ncccc3c2)c(C)nn1 |
| InChI | InChI=1S/C16H13N3O/c1-10-8-14(11(2)19-18-10)16(20)13-5-6-15-12(9-13)4-3-7-17-15/h3-9H,1-2H3 |
| InChIKey | GGQFOMWCXDPZGN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |