C18H14BrNO — CID 114329700
(4-bromo-3,5-dimethylphenyl)-quinolin-6-ylmethanone (PubChem CID 114329700) has the molecular formula C18H14BrNO and a molecular weight of 340.22 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl)-quinolin-6-ylmethanone.
| Compound Name | (4-bromo-3,5-dimethylphenyl)-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 114329700 |
| Molecular Formula | C18H14BrNO |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl)-quinolin-6-ylmethanone |
| SMILES | Cc1cc(C(=O)c2ccc3ncccc3c2)cc(C)c1Br |
| InChI | InChI=1S/C18H14BrNO/c1-11-8-15(9-12(2)17(11)19)18(21)14-5-6-16-13(10-14)4-3-7-20-16/h3-10H,1-2H3 |
| InChIKey | JFQFLTFUTAGSHI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |