C13H14F2OS — CID 105124560
2-(3,4-difluorophenyl)-1-(2-methylthiolan-2-yl)ethanone (PubChem CID 105124560) has the molecular formula C13H14F2OS and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(2-methylthiolan-2-yl)ethanone.
| Compound Name | 2-(3,4-difluorophenyl)-1-(2-methylthiolan-2-yl)ethanone |
|---|---|
| PubChem CID | 105124560 |
| Molecular Formula | C13H14F2OS |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(2-methylthiolan-2-yl)ethanone |
| SMILES | CC1(C(=O)Cc2ccc(F)c(F)c2)CCCS1 |
| InChI | InChI=1S/C13H14F2OS/c1-13(5-2-6-17-13)12(16)8-9-3-4-10(14)11(15)7-9/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | OQQBRRGJJCIURJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |