C14H15FO2S — CID 105125769
1-(2-fluoro-3-methoxyphenyl)-3-thiophen-3-ylpropan-2-ol (PubChem CID 105125769) has the molecular formula C14H15FO2S and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)-3-thiophen-3-ylpropan-2-ol.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)-3-thiophen-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 105125769 |
| Molecular Formula | C14H15FO2S |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)-3-thiophen-3-ylpropan-2-ol |
| SMILES | COc1cccc(CC(O)Cc2ccsc2)c1F |
| InChI | InChI=1S/C14H15FO2S/c1-17-13-4-2-3-11(14(13)15)8-12(16)7-10-5-6-18-9-10/h2-6,9,12,16H,7-8H2,1H3 |
| InChIKey | QRPWMZDYOHQLIR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |