C12H12FNO2S — CID 113453764
2-(2-fluoro-3-methoxyphenyl)-1-(1,3-thiazol-4-yl)ethanol (PubChem CID 113453764) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-1-(1,3-thiazol-4-yl)ethanol.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-1-(1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 113453764 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-1-(1,3-thiazol-4-yl)ethanol |
| SMILES | COc1cccc(CC(O)c2cscn2)c1F |
| InChI | InChI=1S/C12H12FNO2S/c1-16-11-4-2-3-8(12(11)13)5-10(15)9-6-17-7-14-9/h2-4,6-7,10,15H,5H2,1H3 |
| InChIKey | FHUKMMIDYOPWNG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |