C11H18O3 — CID 105127406
1-(3,4-dihydro-2H-pyran-5-yl)-3-propoxypropan-1-one (PubChem CID 105127406) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-3-propoxypropan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-propoxypropan-1-one |
|---|---|
| PubChem CID | 105127406 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-propoxypropan-1-one |
| SMILES | CCCOCCC(=O)C1=COCCC1 |
| InChI | InChI=1S/C11H18O3/c1-2-6-13-8-5-11(12)10-4-3-7-14-9-10/h9H,2-8H2,1H3 |
| InChIKey | BWGVTVQLBQTXIH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|