C11H15N3OS — CID 105128768
1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol (PubChem CID 105128768) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol.
| Compound Name | 1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 105128768 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-(3-methyltriazol-4-yl)-4-thiophen-2-ylbutan-1-ol |
| SMILES | Cn1nncc1C(O)CCCc1cccs1 |
| InChI | InChI=1S/C11H15N3OS/c1-14-10(8-12-13-14)11(15)6-2-4-9-5-3-7-16-9/h3,5,7-8,11,15H,2,4,6H2,1H3 |
| InChIKey | GSSNVFJIJAOOND-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |