C17H21N3S — CID 105134365
1-(benzimidazol-1-yl)-N-propyl-3-thiophen-2-ylpropan-2-amine (PubChem CID 105134365) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-N-propyl-3-thiophen-2-ylpropan-2-amine.
| Compound Name | 1-(benzimidazol-1-yl)-N-propyl-3-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 105134365 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(benzimidazol-1-yl)-N-propyl-3-thiophen-2-ylpropan-2-amine |
| SMILES | CCCNC(Cc1cccs1)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C17H21N3S/c1-2-9-18-14(11-15-6-5-10-21-15)12-20-13-19-16-7-3-4-8-17(16)20/h3-8,10,13-14,18H,2,9,11-12H2,1H3 |
| InChIKey | OHKUYUVPRWOMRZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |