C13H14F2O3S — CID 105135759
1-(2,6-difluorophenyl)-3-(1,1-dioxothiolan-3-yl)propan-2-one (PubChem CID 105135759) has the molecular formula C13H14F2O3S and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(1,1-dioxothiolan-3-yl)propan-2-one.
| Compound Name | 1-(2,6-difluorophenyl)-3-(1,1-dioxothiolan-3-yl)propan-2-one |
|---|---|
| PubChem CID | 105135759 |
| Molecular Formula | C13H14F2O3S |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(1,1-dioxothiolan-3-yl)propan-2-one |
| SMILES | O=C(Cc1c(F)cccc1F)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14F2O3S/c14-12-2-1-3-13(15)11(12)7-10(16)6-9-4-5-19(17,18)8-9/h1-3,9H,4-8H2 |
| InChIKey | ONRIYHNFIVZBFL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |