C16H18BrFN2 — CID 105137133
3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]-N,N-dimethylaniline (PubChem CID 105137133) has the molecular formula C16H18BrFN2 and a molecular weight of 337.24 g/mol. Its IUPAC name is 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]-N,N-dimethylaniline.
| Compound Name | 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105137133 |
| Molecular Formula | C16H18BrFN2 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-[1-amino-2-(4-bromo-2-fluorophenyl)ethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(N)Cc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C16H18BrFN2/c1-20(2)14-5-3-4-12(8-14)16(19)9-11-6-7-13(17)10-15(11)18/h3-8,10,16H,9,19H2,1-2H3 |
| InChIKey | CZIOKJIMWHLCDF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |