C16H17BrFN — CID 115844396
2-(4-bromo-2-fluorophenyl)-1-(3,5-dimethylphenyl)ethanamine (PubChem CID 115844396) has the molecular formula C16H17BrFN and a molecular weight of 322.22 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(3,5-dimethylphenyl)ethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(3,5-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 115844396 |
| Molecular Formula | C16H17BrFN |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(3,5-dimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)cc(C(N)Cc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C16H17BrFN/c1-10-5-11(2)7-13(6-10)16(19)8-12-3-4-14(17)9-15(12)18/h3-7,9,16H,8,19H2,1-2H3 |
| InChIKey | OBDGLKFNIZNJPX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |