C15H15BrFN — CID 62602021
2-(4-bromo-2-fluorophenyl)-1-(3-methylphenyl)ethanamine (PubChem CID 62602021) has the molecular formula C15H15BrFN and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(3-methylphenyl)ethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 62602021 |
| Molecular Formula | C15H15BrFN |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(C(N)Cc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C15H15BrFN/c1-10-3-2-4-12(7-10)15(18)8-11-5-6-13(16)9-14(11)17/h2-7,9,15H,8,18H2,1H3 |
| InChIKey | ZVSZMHKDHVQXDW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |