C14H20O3 — CID 10513980
(3aS,7S,7aR)-7-hydroxy-2,2,7-trimethylspiro[3,3a,4,7a-tetrahydroindene-6,1'-cyclopropane]-1,5-dione (PubChem CID 10513980) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3aS,7S,7aR)-7-hydroxy-2,2,7-trimethylspiro[3,3a,4,7a-tetrahydroindene-6,1'-cyclopropane]-1,5-dione.
| Compound Name | (3aS,7S,7aR)-7-hydroxy-2,2,7-trimethylspiro[3,3a,4,7a-tetrahydroindene-6,1'-cyclopropane]-1,5-dione |
|---|---|
| PubChem CID | 10513980 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3aS,7S,7aR)-7-hydroxy-2,2,7-trimethylspiro[3,3a,4,7a-tetrahydroindene-6,1'-cyclopropane]-1,5-dione |
| SMILES | CC1(C)C[C@H]2CC(=O)C3(CC3)[C@@](C)(O)[C@@H]2C1=O |
| InChI | InChI=1S/C14H20O3/c1-12(2)7-8-6-9(15)14(4-5-14)13(3,17)10(8)11(12)16/h8,10,17H,4-7H2,1-3H3/t8-,10+,13+/m1/s1 |
| InChIKey | RDXPIPGRZLPQFN-DVYJOKAKSA-N |
| XLogP | 1.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |