C16H18FNO2 — CID 105142755
(2,3-dimethoxyphenyl)-(4-fluoro-2-methylphenyl)methanamine (PubChem CID 105142755) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)-(4-fluoro-2-methylphenyl)methanamine.
| Compound Name | (2,3-dimethoxyphenyl)-(4-fluoro-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 105142755 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2,3-dimethoxyphenyl)-(4-fluoro-2-methylphenyl)methanamine |
| SMILES | COc1cccc(C(N)c2ccc(F)cc2C)c1OC |
| InChI | InChI=1S/C16H18FNO2/c1-10-9-11(17)7-8-12(10)15(18)13-5-4-6-14(19-2)16(13)20-3/h4-9,15H,18H2,1-3H3 |
| InChIKey | QAIAANHUJDQDLF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |