C10H15N3S — CID 105149148
N-propyl-1-(1,2,5-thiadiazol-3-yl)pent-4-yn-1-amine (PubChem CID 105149148) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is N-propyl-1-(1,2,5-thiadiazol-3-yl)pent-4-yn-1-amine.
| Compound Name | N-propyl-1-(1,2,5-thiadiazol-3-yl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 105149148 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-propyl-1-(1,2,5-thiadiazol-3-yl)pent-4-yn-1-amine |
| SMILES | C#CCCC(NCCC)c1cnsn1 |
| InChI | InChI=1S/C10H15N3S/c1-3-5-6-9(11-7-4-2)10-8-12-14-13-10/h1,8-9,11H,4-7H2,2H3 |
| InChIKey | VTLKCDDGQOGJLZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|