C14H19NS — CID 105152981
1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-en-1-amine (PubChem CID 105152981) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-en-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-en-1-amine |
|---|---|
| PubChem CID | 105152981 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-en-1-amine |
| SMILES | C=CCCCC(N)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H19NS/c1-2-3-4-8-12(15)14-10-11-7-5-6-9-13(11)16-14/h2,5-7,9,12,14H,1,3-4,8,10,15H2 |
| InChIKey | WJWHZKFFVRSLLD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|