C16H23NS — CID 107012061
1-(2,3-dihydro-1-benzothiophen-2-yl)oct-7-en-1-amine (PubChem CID 107012061) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)oct-7-en-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)oct-7-en-1-amine |
|---|---|
| PubChem CID | 107012061 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)oct-7-en-1-amine |
| SMILES | C=CCCCCCC(N)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H23NS/c1-2-3-4-5-6-10-14(17)16-12-13-9-7-8-11-15(13)18-16/h2,7-9,11,14,16H,1,3-6,10,12,17H2 |
| InChIKey | LDBJAWSEECIUQO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|