C12H23NS2 — CID 107009463
1-(1,4-dithian-2-yl)oct-7-en-1-amine (PubChem CID 107009463) has the molecular formula C12H23NS2 and a molecular weight of 245.46 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)oct-7-en-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)oct-7-en-1-amine |
|---|---|
| PubChem CID | 107009463 |
| Molecular Formula | C12H23NS2 |
| Molecular Weight | 245.46 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1-(1,4-dithian-2-yl)oct-7-en-1-amine |
| SMILES | C=CCCCCCC(N)C1CSCCS1 |
| InChI | InChI=1S/C12H23NS2/c1-2-3-4-5-6-7-11(13)12-10-14-8-9-15-12/h2,11-12H,1,3-10,13H2 |
| InChIKey | VDUZABCLHNWAKO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|