C14H17NS — CID 105179456
1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-yn-1-amine (PubChem CID 105179456) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-yn-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105179456 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-yl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(N)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H17NS/c1-2-3-4-8-12(15)14-10-11-7-5-6-9-13(11)16-14/h1,5-7,9,12,14H,3-4,8,10,15H2 |
| InChIKey | RICDUWFLGAUVMG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|