C16H28BrN3S — CID 105157626
N-[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-methylthiolan-2-yl)ethyl]propan-1-amine (PubChem CID 105157626) has the molecular formula C16H28BrN3S and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-methylthiolan-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-methylthiolan-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105157626 |
| Molecular Formula | C16H28BrN3S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-methylthiolan-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(Br)c(CC)nn1C)C1(C)CCCS1 |
| InChI | InChI=1S/C16H28BrN3S/c1-5-9-18-14(16(3)8-7-10-21-16)11-13-15(17)12(6-2)19-20(13)4/h14,18H,5-11H2,1-4H3 |
| InChIKey | RYYGUYYFOVVBGL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |