C15H26BrN3S — CID 105159661
2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(2-methylthiolan-2-yl)ethanamine (PubChem CID 105159661) has the molecular formula C15H26BrN3S and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(2-methylthiolan-2-yl)ethanamine.
| Compound Name | 2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(2-methylthiolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 105159661 |
| Molecular Formula | C15H26BrN3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(2-methylthiolan-2-yl)ethanamine |
| SMILES | CCNC(Cc1c(Br)c(C)nn1CC)C1(C)CCCS1 |
| InChI | InChI=1S/C15H26BrN3S/c1-5-17-13(15(4)8-7-9-20-15)10-12-14(16)11(3)18-19(12)6-2/h13,17H,5-10H2,1-4H3 |
| InChIKey | GCAPONLRPMAQER-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |