C11H21NO2S — CID 105161131
1-(1,1-dioxothiolan-3-yl)-N-propylbut-3-en-2-amine (PubChem CID 105161131) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-propylbut-3-en-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-propylbut-3-en-2-amine |
|---|---|
| PubChem CID | 105161131 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-propylbut-3-en-2-amine |
| SMILES | C=CC(CC1CCS(=O)(=O)C1)NCCC |
| InChI | InChI=1S/C11H21NO2S/c1-3-6-12-11(4-2)8-10-5-7-15(13,14)9-10/h4,10-12H,2-3,5-9H2,1H3 |
| InChIKey | IXKCCTKDYVORPS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|