C14H27NS — CID 105162960
4-methyl-N-propyl-1-(thian-4-yl)pent-4-en-2-amine (PubChem CID 105162960) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is 4-methyl-N-propyl-1-(thian-4-yl)pent-4-en-2-amine.
| Compound Name | 4-methyl-N-propyl-1-(thian-4-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 105162960 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 4-methyl-N-propyl-1-(thian-4-yl)pent-4-en-2-amine |
| SMILES | C=C(C)CC(CC1CCSCC1)NCCC |
| InChI | InChI=1S/C14H27NS/c1-4-7-15-14(10-12(2)3)11-13-5-8-16-9-6-13/h13-15H,2,4-11H2,1,3H3 |
| InChIKey | WXFBDRFWKOTFNE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|