C12H23NS — CID 105163018
N,4-dimethyl-1-(thian-4-yl)pent-4-en-2-amine (PubChem CID 105163018) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is N,4-dimethyl-1-(thian-4-yl)pent-4-en-2-amine.
| Compound Name | N,4-dimethyl-1-(thian-4-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 105163018 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N,4-dimethyl-1-(thian-4-yl)pent-4-en-2-amine |
| SMILES | C=C(C)CC(CC1CCSCC1)NC |
| InChI | InChI=1S/C12H23NS/c1-10(2)8-12(13-3)9-11-4-6-14-7-5-11/h11-13H,1,4-9H2,2-3H3 |
| InChIKey | SIXINPGWVWQFOF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|