C10H19NO2S — CID 105163280
1-(1,1-dioxothiolan-3-yl)-4-methylpent-3-en-2-amine (PubChem CID 105163280) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methylpent-3-en-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-methylpent-3-en-2-amine |
|---|---|
| PubChem CID | 105163280 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-methylpent-3-en-2-amine |
| SMILES | CC(C)=CC(N)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO2S/c1-8(2)5-10(11)6-9-3-4-14(12,13)7-9/h5,9-10H,3-4,6-7,11H2,1-2H3 |
| InChIKey | QOLCSTAHHXBXLG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|