C9H19NS — CID 105163441
N,5-dimethyl-1-methylsulfanylhex-4-en-3-amine (PubChem CID 105163441) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is N,5-dimethyl-1-methylsulfanylhex-4-en-3-amine.
| Compound Name | N,5-dimethyl-1-methylsulfanylhex-4-en-3-amine |
|---|---|
| PubChem CID | 105163441 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N,5-dimethyl-1-methylsulfanylhex-4-en-3-amine |
| SMILES | CNC(C=C(C)C)CCSC |
| InChI | InChI=1S/C9H19NS/c1-8(2)7-9(10-3)5-6-11-4/h7,9-10H,5-6H2,1-4H3 |
| InChIKey | ZVFDLGKZBBAUCV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|