methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate

C16H26O4 — CID 10517030

IUPACmethyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate
SMILESCCCC/C(C(=O)OC)=C1/C=C(CC)C(CC)(OC)O1
InChIInChI=1S/C16H26O4/c1-6-9-10-13(15(17)18-4)14-11-12(7-2)16(8-3,19-5)20-14/h11H,6-10H2,1-5H3/b14-13+
InChIKeyMBFUBWBBLGLNLR-BUHFOSPRSA-N
MW282.38 g/mol
LogP3.72
Rot. Bonds7

About methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate

methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate (PubChem CID 10517030) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate.

Molecular Properties

Compound Namemethyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate
PubChem CID10517030
Molecular FormulaC16H26O4
Molecular Weight282.38 g/mol
Exact Mass282.18
IUPAC Namemethyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate
SMILESCCCC/C(C(=O)OC)=C1/C=C(CC)C(CC)(OC)O1
InChIInChI=1S/C16H26O4/c1-6-9-10-13(15(17)18-4)14-11-12(7-2)16(8-3,19-5)20-14/h11H,6-10H2,1-5H3/b14-13+
InChIKeyMBFUBWBBLGLNLR-BUHFOSPRSA-N
XLogP3.72
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.38
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate?
The IUPAC name of methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate (CID 10517030) is methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate.
What is the SMILES notation for methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate?
The canonical SMILES for methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate is CCCC/C(C(=O)OC)=C1/C=C(CC)C(CC)(OC)O1.
What is the InChIKey of methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate?
The InChIKey is MBFUBWBBLGLNLR-BUHFOSPRSA-N. The full InChI is InChI=1S/C16H26O4/c1-6-9-10-13(15(17)18-4)14-11-12(7-2)16(8-3,19-5)20-14/h11H,6-10H2,1-5H3/b14-13+.
What are the key properties of methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate?
methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate has a molecular weight of 282.38 g/mol, XLogP of 3.72, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(4,5-diethyl-5-methoxyfuran-2-ylidene)hexanoate is sourced from PubChem (CID 10517030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).