C17H34OSi — CID 10517057
(3R,4S,5S)-5-but-3-en-2-yl-2,2-ditert-butyl-3,4-dimethyloxasilolane (PubChem CID 10517057) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is (3R,4S,5S)-5-but-3-en-2-yl-2,2-ditert-butyl-3,4-dimethyloxasilolane.
| Compound Name | (3R,4S,5S)-5-but-3-en-2-yl-2,2-ditert-butyl-3,4-dimethyloxasilolane |
|---|---|
| PubChem CID | 10517057 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (3R,4S,5S)-5-but-3-en-2-yl-2,2-ditert-butyl-3,4-dimethyloxasilolane |
| SMILES | C=CC(C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C17H34OSi/c1-11-12(2)15-13(3)14(4)19(18-15,16(5,6)7)17(8,9)10/h11-15H,1H2,2-10H3/t12?,13-,14-,15+/m1/s1 |
| InChIKey | XUFRZQHGTQIMEM-NUDNTCICSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|