C14H15Cl2NO — CID 10517139
(1R,2R,3R,4S)-3-(3,4-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 10517139) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-(3,4-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3R,4S)-3-(3,4-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 10517139 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (1R,2R,3R,4S)-3-(3,4-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@@H]2CC[C@@H](C2)[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2NO/c15-10-4-3-9(6-11(10)16)12-7-1-2-8(5-7)13(12)14(17)18/h3-4,6-8,12-13H,1-2,5H2,(H2,17,18)/t7-,8+,12-,13+/m0/s1 |
| InChIKey | PUFLRTKQIDDJLW-HYRRULHTSA-N |
| XLogP | 3.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |