C15H18BrN3O — CID 54500226
(2R,3R)-3-(4-bromophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 54500226) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is (2R,3R)-3-(4-bromophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (2R,3R)-3-(4-bromophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 54500226 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (2R,3R)-3-(4-bromophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(N)=NC(=O)[C@@H]1C2CCC(C2)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrN3O/c16-11-5-3-8(4-6-11)12-9-1-2-10(7-9)13(12)14(20)19-15(17)18/h3-6,9-10,12-13H,1-2,7H2,(H4,17,18,19,20)/t9?,10?,12-,13-/m1/s1 |
| InChIKey | YBWXYYYGLKTVNP-IOCWDNCASA-N |
| XLogP | 2.38 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|