C15H17ClFN3O — CID 54160583
(2R,3R)-3-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 54160583) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is (2R,3R)-3-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (2R,3R)-3-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 54160583 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2R,3R)-3-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC(N)=NC(=O)[C@@H]1C2CCC(C2)[C@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClFN3O/c16-10-6-9(3-4-11(10)17)12-7-1-2-8(5-7)13(12)14(21)20-15(18)19/h3-4,6-8,12-13H,1-2,5H2,(H4,18,19,20,21)/t7?,8?,12-,13+/m0/s1 |
| InChIKey | OOCPPJAVWXPWIA-DLLFPRDZSA-N |
| XLogP | 2.41 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|