C19H20ClFN4O — CID 54251457
(3R,4S)-1-benzyl-4-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)pyrrolidine-3-carboxamide (PubChem CID 54251457) has the molecular formula C19H20ClFN4O and a molecular weight of 374.85 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-1-benzyl-4-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 54251457 |
| Molecular Formula | C19H20ClFN4O |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(3-chloro-4-fluorophenyl)-N-(diaminomethylidene)pyrrolidine-3-carboxamide |
| SMILES | NC(N)=NC(=O)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClFN4O/c20-16-8-13(6-7-17(16)21)14-10-25(9-12-4-2-1-3-5-12)11-15(14)18(26)24-19(22)23/h1-8,14-15H,9-11H2,(H4,22,23,24,26)/t14-,15+/m1/s1 |
| InChIKey | QXAQMUKQKUAYBS-CABCVRRESA-N |
| XLogP | 2.49 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|