C12H18ClN5 — CID 105183128
(4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanamine (PubChem CID 105183128) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanamine.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105183128 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methanamine |
| SMILES | CCc1cc(C(N)c2c(Cl)cnn2CC)n(C)n1 |
| InChI | InChI=1S/C12H18ClN5/c1-4-8-6-10(17(3)16-8)11(14)12-9(13)7-15-18(12)5-2/h6-7,11H,4-5,14H2,1-3H3 |
| InChIKey | ABPYVJDMXMGBHO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |