C17H18FNOS — CID 105185849
1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-4-thiophen-2-ylbutan-1-amine (PubChem CID 105185849) has the molecular formula C17H18FNOS and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 105185849 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(5-fluoro-1-benzofuran-2-yl)-N-methyl-4-thiophen-2-ylbutan-1-amine |
| SMILES | CNC(CCCc1cccs1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H18FNOS/c1-19-15(6-2-4-14-5-3-9-21-14)17-11-12-10-13(18)7-8-16(12)20-17/h3,5,7-11,15,19H,2,4,6H2,1H3 |
| InChIKey | YIXOYYYSJCKJRM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |