C19H23NOS — CID 10519280
(E)-1-(benzenesulfinyl)-N,N-diethyl-3-phenylprop-1-en-2-amine (PubChem CID 10519280) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is (E)-1-(benzenesulfinyl)-N,N-diethyl-3-phenylprop-1-en-2-amine.
| Compound Name | (E)-1-(benzenesulfinyl)-N,N-diethyl-3-phenylprop-1-en-2-amine |
|---|---|
| PubChem CID | 10519280 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (E)-1-(benzenesulfinyl)-N,N-diethyl-3-phenylprop-1-en-2-amine |
| SMILES | CCN(CC)/C(=C/S(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NOS/c1-3-20(4-2)18(15-17-11-7-5-8-12-17)16-22(21)19-13-9-6-10-14-19/h5-14,16H,3-4,15H2,1-2H3/b18-16+ |
| InChIKey | KBIGFZIBQGMSDJ-FBMGVBCBSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |