C12H17NO2S — CID 57071147
1-benzylsulfinyl-N,N-diethylformamide (PubChem CID 57071147) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-benzylsulfinyl-N,N-diethylformamide.
| Compound Name | 1-benzylsulfinyl-N,N-diethylformamide |
|---|---|
| PubChem CID | 57071147 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1-benzylsulfinyl-N,N-diethylformamide |
| SMILES | CCN(CC)C(=O)S(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO2S/c1-3-13(4-2)12(14)16(15)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | QJJWXTMEHHOKMD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|