C15H20F2O3S — CID 10519595
2-(benzenesulfonyl)-3,3-difluorononan-4-one (PubChem CID 10519595) has the molecular formula C15H20F2O3S and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3,3-difluorononan-4-one.
| Compound Name | 2-(benzenesulfonyl)-3,3-difluorononan-4-one |
|---|---|
| PubChem CID | 10519595 |
| Molecular Formula | C15H20F2O3S |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(benzenesulfonyl)-3,3-difluorononan-4-one |
| SMILES | CCCCCC(=O)C(F)(F)C(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20F2O3S/c1-3-4-6-11-14(18)15(16,17)12(2)21(19,20)13-9-7-5-8-10-13/h5,7-10,12H,3-4,6,11H2,1-2H3 |
| InChIKey | HPKRCMOFXOIFQZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|