C17H23NO3S — CID 10519818
methyl 3-cyano-3-hydroxy-4-(5-phenylpentylsulfanyl)butanoate (PubChem CID 10519818) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is methyl 3-cyano-3-hydroxy-4-(5-phenylpentylsulfanyl)butanoate.
| Compound Name | methyl 3-cyano-3-hydroxy-4-(5-phenylpentylsulfanyl)butanoate |
|---|---|
| PubChem CID | 10519818 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl 3-cyano-3-hydroxy-4-(5-phenylpentylsulfanyl)butanoate |
| SMILES | COC(=O)CC(O)(C#N)CSCCCCCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3S/c1-21-16(19)12-17(20,13-18)14-22-11-7-3-6-10-15-8-4-2-5-9-15/h2,4-5,8-9,20H,3,6-7,10-12,14H2,1H3 |
| InChIKey | XBFHYJUXIXUXRQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|