C12H26N2O — CID 105206434
[1-(3,4-dimethylcyclohexyl)-3-methoxypropyl]hydrazine (PubChem CID 105206434) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is [1-(3,4-dimethylcyclohexyl)-3-methoxypropyl]hydrazine.
| Compound Name | [1-(3,4-dimethylcyclohexyl)-3-methoxypropyl]hydrazine |
|---|---|
| PubChem CID | 105206434 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | [1-(3,4-dimethylcyclohexyl)-3-methoxypropyl]hydrazine |
| SMILES | COCCC(NN)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C12H26N2O/c1-9-4-5-11(8-10(9)2)12(14-13)6-7-15-3/h9-12,14H,4-8,13H2,1-3H3 |
| InChIKey | MARNEHSSSZKUON-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|