About (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate
(4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate (PubChem CID 10520810) has the molecular formula C15H17N3O2S2
and a molecular weight of 335.45 g/mol. Its IUPAC name is (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate.
Molecular Properties
| Compound Name | (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate |
| PubChem CID | 10520810 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate |
| SMILES | CC1=Nc2ccccc2NC(=O)C1SC(=S)N1CCOCC1 |
| InChI | InChI=1S/C15H17N3O2S2/c1-10-13(22-15(21)18-6-8-20-9-7-18)14(19)17-12-5-3-2-4-11(12)16-10/h2-5,13H,6-9H2,1H3,(H,17,19) |
| InChIKey | HYBJTLTYSCCAJH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate?
The IUPAC name of (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate (CID 10520810) is (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate.
What is the SMILES notation for (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate?
The canonical SMILES for (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate is CC1=Nc2ccccc2NC(=O)C1SC(=S)N1CCOCC1.
What is the InChIKey of (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate?
The InChIKey is HYBJTLTYSCCAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S2/c1-10-13(22-15(21)18-6-8-20-9-7-18)14(19)17-12-5-3-2-4-11(12)16-10/h2-5,13H,6-9H2,1H3,(H,17,19).
What are the key properties of (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate?
(4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate has a molecular weight of 335.45 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-oxo-1,3-dihydro-1,5-benzodiazepin-3-yl) morpholine-4-carbodithioate is sourced from PubChem (CID 10520810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).