C18H12N2O3S — CID 10520850
4-[4-(4-methylphenyl)-5-sulfanylidene-1,2,4-oxadiazol-3-yl]chromen-2-one (PubChem CID 10520850) has the molecular formula C18H12N2O3S and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)-5-sulfanylidene-1,2,4-oxadiazol-3-yl]chromen-2-one.
| Compound Name | 4-[4-(4-methylphenyl)-5-sulfanylidene-1,2,4-oxadiazol-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 10520850 |
| Molecular Formula | C18H12N2O3S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 4-[4-(4-methylphenyl)-5-sulfanylidene-1,2,4-oxadiazol-3-yl]chromen-2-one |
| SMILES | Cc1ccc(-n2c(-c3cc(=O)oc4ccccc34)noc2=S)cc1 |
| InChI | InChI=1S/C18H12N2O3S/c1-11-6-8-12(9-7-11)20-17(19-23-18(20)24)14-10-16(21)22-15-5-3-2-4-13(14)15/h2-10H,1H3 |
| InChIKey | JJSJAMUPELDULG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|