C12H9NO3S — CID 139225873
3-(4-methylphenyl)-2-sulfanylidene-1,3-oxazepine-4,7-dione (PubChem CID 139225873) has the molecular formula C12H9NO3S and a molecular weight of 247.28 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-sulfanylidene-1,3-oxazepine-4,7-dione.
| Compound Name | 3-(4-methylphenyl)-2-sulfanylidene-1,3-oxazepine-4,7-dione |
|---|---|
| PubChem CID | 139225873 |
| Molecular Formula | C12H9NO3S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 3-(4-methylphenyl)-2-sulfanylidene-1,3-oxazepine-4,7-dione |
| SMILES | Cc1ccc(-n2c(=O)ccc(=O)oc2=S)cc1 |
| InChI | InChI=1S/C12H9NO3S/c1-8-2-4-9(5-3-8)13-10(14)6-7-11(15)16-12(13)17/h2-7H,1H3 |
| InChIKey | LZZGBKNGGHPVAL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|