C14H11BrN2O — CID 58016320
2-bromo-7-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-one (PubChem CID 58016320) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is 2-bromo-7-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-one.
| Compound Name | 2-bromo-7-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 58016320 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-bromo-7-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-one |
| SMILES | Cc1ccc(-n2c(=O)ccc3cc(Br)[nH]c32)cc1 |
| InChI | InChI=1S/C14H11BrN2O/c1-9-2-5-11(6-3-9)17-13(18)7-4-10-8-12(15)16-14(10)17/h2-8,16H,1H3 |
| InChIKey | ZSLBKFKAHAUXPC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |